Compound Q&A

What are the physical and chemical properties of (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8)?

Answer

(2R)-2-Amino-4-pentynoic acid hydrochloride (1:1)
(2R)-2-Amino-4-pentynoic acid hydrochloride is a white crystalline solid with a molecular weight of approximately 217.68 g/mol. It is slightly soluble in water, with a solubility of about 0.34 g/100 mL at 20°C. Chemically, it is highly reactive due to its amino group and the presence of a carboxylic acid chloride, making it susceptible to nucleophilic substitution and condensation reactions.

About

CAS No 87205-47-8
English Name (2R)-2-Amino-4-pentynoic acid hydrochloride (1:1)
Molecular Formula C5H8ClNO2
Molecular Weight 16.04 g/mol
SMILES C#CC[C@@H](N)C(O)=O.[H]Cl
InChIKey UAMBUICGODABQY-PGMHMLKASA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8) typically synthesized?

(2R)-2-Amino-4-pentynoic acid hydrochloride is typically synthesized by reacting 2-amino-4-pentynoic...

Compound Q&A

What industries use (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8)?

(2R)-2-Amino-4-pentynoic acid hydrochloride is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8)?

When handling (2R)-2-Amino-4-pentynoic acid hydrochloride, appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...