Compound Q&A

What industries use 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6)?

Answer

4-Bromo-2-chloro-5-fluorobenzoic acid
4-Bromo-2-chloro-5-fluorobenzoic acid is used in pharmaceuticals for the synthesis of intermediates and in analytical chemistry for sensor applications. Its role in polymer synthesis and semiconductor manufacturing is also recognized, but on a smaller scale compared to pharmaceutical and analytical uses.

About

CAS No 64742-95-6
English Name 4-Bromo-2-chloro-5-fluorobenzoic acid
Molecular Formula C7H3BrClFO2
Molecular Weight 253.45 g/mol
SMILES c1c(c(cc(c1F)Br)Cl)C(=O)O
InChIKey TZFKKLGCVKORLS-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6)?

4-Bromo-2-chloro-5-fluorobenzoic acid is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6) typically synthesized?

4-Bromo-2-chloro-5-fluorobenzoic acid is synthesized via an electrophilic aromatic substitution rout...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6)?

When handling 4-Bromo-2-chloro-5-fluorobenzoic acid, use appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...