Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6)?

Answer

4-Bromo-2-chloro-5-fluorobenzoic acid
4-Bromo-2-chloro-5-fluorobenzoic acid is a crystalline solid with a molecular weight of approximately 267.02 g/mol. It has a low solubility in water (0.3 g/L at 20°C) but dissolves well in organic solvents like ethanol and acetonitrile. This compound is known for its reactivity, particularly towards nucleophilic substitution reactions at the aromatic ring.

About

CAS No 64742-95-6
English Name 4-Bromo-2-chloro-5-fluorobenzoic acid
Molecular Formula C7H3BrClFO2
Molecular Weight 253.45 g/mol
SMILES c1c(c(cc(c1F)Br)Cl)C(=O)O
InChIKey TZFKKLGCVKORLS-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6) typically synthesized?

4-Bromo-2-chloro-5-fluorobenzoic acid is synthesized via an electrophilic aromatic substitution rout...

Compound Q&A

What industries use 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6)?

4-Bromo-2-chloro-5-fluorobenzoic acid is used in pharmaceuticals for the synthesis of intermediates ...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-chloro-5-fluorobenzoic acid (CAS: 64742-95-6)?

When handling 4-Bromo-2-chloro-5-fluorobenzoic acid, use appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...