Compound Q&A

How is 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1) typically synthesized?

Answer

3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide
3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide is typically synthesized through the reaction of 1,2-benzothiazole with allyl bromide followed by oxidation using a suitable oxidizing agent like Dess-Martin periodinane. The reaction involves the introduction of an allyl group and subsequent oxidation to form the 1,1-dioxide structure.

About

CAS No 27605-76-1
English Name 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C=CCOC1=NS(=O)(=O)C2=CC=CC=C21
InChIKey WHHIPMZEDGBUCC-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1)?

3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1) is a solid with a crystalline form. It ...

Compound Q&A

What industries use 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1)?

3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1) is used in various industries, includin...

Compound Q&A

What precautions should be taken when handling 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1)?

When handling 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...