Compound Q&A

What are the physical and chemical properties of 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1)?

Answer

3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide
3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1) is a solid with a crystalline form. It has a molecular weight of approximately 260.26 g/mol and is slightly soluble in common organic solvents like ethanol and acetone. This compound is known for its reactivity, particularly towards nucleophilic substitution and oxidation reactions.

About

CAS No 27605-76-1
English Name 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C=CCOC1=NS(=O)(=O)C2=CC=CC=C21
InChIKey WHHIPMZEDGBUCC-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1) typically synthesized?

3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide is typically synthesized through the reaction of 1,2-benz...

Compound Q&A

What industries use 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1)?

3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1) is used in various industries, includin...

Compound Q&A

What precautions should be taken when handling 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1)?

When handling 3-(Allyloxy)-1,2-benzothiazole 1,1-dioxide (CAS: 27605-76-1), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...