Compound Q&A

How is dichlororuthenium (CAS: 145926-28-9) typically synthesized?

Answer

dichlororuthenium; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane; 1-isopropyl-4-methyl-benzene
Dichlororuthenium (CAS: 145926-28-9) can be synthesized via the chlorination of ruthenium(II) salts in the presence of chlorine gas. This process requires careful control of reaction conditions to achieve high selectivity and yield. Catalysts such as palladium or platinum can be used to improve the reaction efficiency.

About

English Name dichlororuthenium; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane; 1-isopropyl-4-methyl-benzene
Molecular Formula C54H46Cl2P2Ru
Molecular Weight 928.9 g/mol
SMILES CC1=CC=C(C=C1)C(C)C.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8.Cl[Ru]Cl
InChIKey WNHLGYRPKARUHY-UHFFFAOYSA-L
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of dichlororuthenium (CAS: 145926-28-9)?

Dichlororuthenium (CAS: 145926-28-9) is a purple solid with a molecular weight of approximately 297....

Compound Q&A

What industries use dichlororuthenium (CAS: 145926-28-9)?

Dichlororuthenium (CAS: 145926-28-9) is used in the pharmaceutical industry for catalysts in organic...

Compound Q&A

What precautions should be taken when handling dichlororuthenium (CAS: 145926-28-9)?

When handling dichlororuthenium (CAS: 145926-28-9), appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...