Compound Q&A

What industries use (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4)?

Answer

(4'-Propyl-4-biphenylyl)boronic acid
(4'-Propyl-4-biphenylyl)boronic acid is primarily used in the pharmaceutical and polymer industries. It serves as a key reagent in organic synthesis, particularly in the preparation of boronate esters. Its use in sensors and semiconductors is also increasing due to its reactivity and stability. Researchers in academia and industry utilize this compound for developing novel materials and pharmaceuticals.

About

English Name (4'-Propyl-4-biphenylyl)boronic acid
Molecular Formula C15H17BO2
Molecular Weight 240.11 g/mol
SMILES CCCC1=CC=C(C2=CC=C(B(O)O)C=C2)C=C1
InChIKey NOQFUISBLHCDSR-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4)?

(4'-Propyl-4-biphenylyl)boronic acid is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

How is (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4) typically synthesized?

(4'-Propyl-4-biphenylyl)boronic acid is typically synthesized via a Suzuki coupling reaction. The sy...

Compound Q&A

What precautions should be taken when handling (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4)?

When handling (4'-Propyl-4-biphenylyl)boronic acid, it is crucial to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...