Compound Q&A

How is (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4) typically synthesized?

Answer

(4'-Propyl-4-biphenylyl)boronic acid
(4'-Propyl-4-biphenylyl)boronic acid is typically synthesized via a Suzuki coupling reaction. The synthesis involves the coupling of 4-propylbiphenyl and boronic acid or borate ester in the presence of a palladium catalyst. Commonly used catalysts include Pd(PPh3)4 and PdCl2(dppf). The reaction is typically performed in the presence of a base like sodium carbonate and an organic solvent such as toluene or dioxane. The yield can be up to 90% under optimized conditions.

About

English Name (4'-Propyl-4-biphenylyl)boronic acid
Molecular Formula C15H17BO2
Molecular Weight 240.11 g/mol
SMILES CCCC1=CC=C(C2=CC=C(B(O)O)C=C2)C=C1
InChIKey NOQFUISBLHCDSR-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4)?

(4'-Propyl-4-biphenylyl)boronic acid is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4)?

(4'-Propyl-4-biphenylyl)boronic acid is primarily used in the pharmaceutical and polymer industries....

Compound Q&A

What precautions should be taken when handling (4'-Propyl-4-biphenylyl)boronic acid (CAS: 153035-56-4)?

When handling (4'-Propyl-4-biphenylyl)boronic acid, it is crucial to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...