Compound Q&A

What industries use 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7)?

Answer

6-Methylheptyl (2,4-dichlorophenoxy)acetate
6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) is primarily used in the agricultural industry as a herbicide. It can also find applications in the pharmaceutical industry, particularly in the synthesis of certain drugs. Additionally, it may be used in polymer synthesis, as a raw material for the production of various organic compounds, and in the manufacturing of sensors and semiconductors for electronic devices.

About

CAS No 25168-26-7
English Name 6-Methylheptyl (2,4-dichlorophenoxy)acetate
Molecular Formula C16H22Cl2O3
Molecular Weight 333.26 g/mol
SMILES CC(C)CCCCCOC(=O)COC1=C(C=C(C=C1)Cl)Cl
InChIKey BBPLSOGERZQYQC-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7)?

6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) is a white or off-white crystalline so...

Compound Q&A

How is 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) typically synthesized?

6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) is typically synthesized via the ester...

Compound Q&A

What precautions should be taken when handling 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7)?

When handling 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...