Compound Q&A

How is 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) typically synthesized?

Answer

6-Methylheptyl (2,4-dichlorophenoxy)acetate
6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) is typically synthesized via the esterification reaction of 2,4-dichlorophenoxyacetic acid with 6-methylheptyl alcohol in the presence of an acid catalyst such as sulfuric acid. The reaction is carried out under reflux conditions to ensure complete conversion. The yield is generally around 85-90%, and the reaction is highly selective, with minimal by-products formed.

About

CAS No 25168-26-7
English Name 6-Methylheptyl (2,4-dichlorophenoxy)acetate
Molecular Formula C16H22Cl2O3
Molecular Weight 333.26 g/mol
SMILES CC(C)CCCCCOC(=O)COC1=C(C=C(C=C1)Cl)Cl
InChIKey BBPLSOGERZQYQC-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7)?

6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) is a white or off-white crystalline so...

Compound Q&A

What industries use 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7)?

6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7) is primarily used in the agricultural ...

Compound Q&A

What precautions should be taken when handling 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7)?

When handling 6-Methylheptyl (2,4-dichlorophenoxy)acetate (CAS: 25168-26-7), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...