Compound Q&A

How should [3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine (CAS: 175277-74-4) be stored?

Answer

[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine
[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine should be stored in a cool, dry place, away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent degradation. Store it in a well-ventilated area to avoid the accumulation of potentially flammable gases. Do not store it near incompatible materials such as strong acids or oxidizers. Follow the manufacturer's guidelines for specific storage instructions.

About

English Name [3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine
Molecular Formula C7H6ClF3N2
Molecular Weight 210.59 g/mol
SMILES C1=C(C=NC(=C1Cl)CN)C(F)(F)F
InChIKey JVQYWHGODHSTAM-UHFFFAOYSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What is [3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine (CAS: 175277-74-4)?

[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine is a chemical compound with the CAS number 175...

Compound Q&A

What are the main uses of [3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine (CAS: 175277-74-4)?

[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine is primarily used as an intermediate in the ph...

Compound Q&A

Is [3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine (CAS: 175277-74-4) safe?

[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methanamine is generally considered safe when handled with...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...