Compound Q&A

What are the main uses of 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9)?

Answer

2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid
2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) is primarily used as an intermediate in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in research for studying organic chemistry and medicinal chemistry.

About

English Name 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES OC(=O)c1cc(=O)[nH]c(n1)C2CC2
InChIKey IKDLJHIRCTZDND-UHFFFAOYSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What is 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9)?

2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) is an organic compound with ...

Compound Q&A

Is 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) safe?

2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) is generally considered safe...

Compound Q&A

How should 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) be stored?

2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) should be stored in a tightl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...