Compound Q&A

What is 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9)?

Answer

2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid
2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) is an organic compound with a molecular structure that includes a pyrimidine ring, a cyclopropyl substituent, and a hydroxy group attached to the 6-position of the pyrimidine ring. It has a carboxylic acid functional group at the 4-position. This compound is commonly used in pharmaceuticals as an intermediate or building block for drug synthesis.

About

English Name 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES OC(=O)c1cc(=O)[nH]c(n1)C2CC2
InChIKey IKDLJHIRCTZDND-UHFFFAOYSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What are the main uses of 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9)?

2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) is primarily used as an inte...

Compound Q&A

Is 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) safe?

2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) is generally considered safe...

Compound Q&A

How should 2-cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) be stored?

2-Cyclopropyl-6-hydroxy-pyrimidine-4-carboxylic acid (CAS: 858956-25-9) should be stored in a tightl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...