Compound Q&A

How should Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) be stored?

Answer

Diisobutyl 1,2-perylenedicarboxylate
Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent contamination and degradation. Proper storage conditions are essential to maintain its stability and effectiveness for use in various applications.

About

CAS No 79869-59-3
English Name Diisobutyl 1,2-perylenedicarboxylate
Molecular Formula C30H28O4
Molecular Weight 452.55 g/mol
SMILES CC(C)COC(=O)C1=C(C2=C3C(=C1)C=CC=C3C4=CC=CC5=C4C2=CC=C5)C(=O)OCC(C)C
InChIKey SDKNPMBAQGMLAD-UHFFFAOYSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What is Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3)?

Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) is an organic compound with a molecular formu...

Compound Q&A

What are the main uses of Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3)?

Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) is primarily used as a precursor in the synth...

Compound Q&A

Is Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) safe?

Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) is generally considered safe when handled wit...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...