Compound Q&A

What is Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3)?

Answer

Diisobutyl 1,2-perylenedicarboxylate
Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) is an organic compound with a molecular formula of C20H24O4. It is derived from perylene dicarboxylic acid and is characterized by its high melting point and stability. This compound is used in various applications due to its unique chemical properties.

About

CAS No 79869-59-3
English Name Diisobutyl 1,2-perylenedicarboxylate
Molecular Formula C30H28O4
Molecular Weight 452.55 g/mol
SMILES CC(C)COC(=O)C1=C(C2=C3C(=C1)C=CC=C3C4=CC=CC5=C4C2=CC=C5)C(=O)OCC(C)C
InChIKey SDKNPMBAQGMLAD-UHFFFAOYSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What are the main uses of Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3)?

Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) is primarily used as a precursor in the synth...

Compound Q&A

Is Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) safe?

Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) is generally considered safe when handled wit...

Compound Q&A

How should Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) be stored?

Diisobutyl 1,2-perylenedicarboxylate (CAS: 79869-59-3) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...