Compound Q&A

How should (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3) be stored?

Answer

(2,3-Dichlorophenyl)boronic acid
(2,3-Dichlorophenyl)boronic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption and degradation. Proper storage conditions are essential to maintain its stability and reactivity for optimal performance in chemical syntheses and applications.

About

English Name (2,3-Dichlorophenyl)boronic acid
Molecular Formula C6H5BCl2O2
Molecular Weight 190.82 g/mol
SMILES B(C1=C(C(=CC=C1)Cl)Cl)(O)O
InChIKey TYIKXPOMOYDGCS-UHFFFAOYSA-N
Last Updated: 2025-10-12 23:04

Related Q&A

Compound Q&A

What is (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3)?

(2,3-Dichlorophenyl)boronic acid is a chemical compound with the molecular formula C8H5Cl2BO2. It is...

Compound Q&A

What are the main uses of (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3)?

(2,3-Dichlorophenyl)boronic acid is primarily used in organic synthesis, particularly in the Suzuki-...

Compound Q&A

Is (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3) safe?

While (2,3-Dichlorophenyl)boronic acid is generally considered safe for laboratory use when proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...