Compound Q&A

What is (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3)?

Answer

(2,3-Dichlorophenyl)boronic acid
(2,3-Dichlorophenyl)boronic acid is a chemical compound with the molecular formula C8H5Cl2BO2. It is a white or off-white crystalline solid with a molar mass of approximately 228.05 g/mol. This compound is characterized by its aromatic nature and boron-carbon bond, which makes it useful in various chemical reactions and synthetic pathways.

About

English Name (2,3-Dichlorophenyl)boronic acid
Molecular Formula C6H5BCl2O2
Molecular Weight 190.82 g/mol
SMILES B(C1=C(C(=CC=C1)Cl)Cl)(O)O
InChIKey TYIKXPOMOYDGCS-UHFFFAOYSA-N
Last Updated: 2025-10-12 23:04

Related Q&A

Compound Q&A

What are the main uses of (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3)?

(2,3-Dichlorophenyl)boronic acid is primarily used in organic synthesis, particularly in the Suzuki-...

Compound Q&A

Is (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3) safe?

While (2,3-Dichlorophenyl)boronic acid is generally considered safe for laboratory use when proper p...

Compound Q&A

How should (2,3-Dichlorophenyl)boronic acid (CAS: 151169-74-3) be stored?

(2,3-Dichlorophenyl)boronic acid should be stored in a cool, dry place away from direct sunlight and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...