Compound Q&A

What are the main uses of Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1)?

Answer

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate
Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate is primarily used in pharmaceuticals as a potential intermediate or precursor for the synthesis of other compounds. It can also be used in research and development for its unique chemical properties. Additionally, it may have applications in the cosmetic industry and as a chemical reagent.

About

CAS No 87460-09-1
English Name Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate
Molecular Formula C19H23O4P
Molecular Weight 346.36 g/mol
SMILES C1=CC=C(C=C1)CCCCP(=O)(CC(=O)OCC2=CC=CC=C2)O
InChIKey GVDMCYBWLREELG-UHFFFAOYSA-N
Last Updated: 2025-10-12 15:22

Related Q&A

Compound Q&A

What is Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1)?

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate is a chemical compound with the CAS number 87460-09-...

Compound Q&A

Is Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1) safe?

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate is generally considered safe for laboratory use when...

Compound Q&A

How should Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1) be stored?

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...