Compound Q&A

What is Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1)?

Answer

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate
Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate is a chemical compound with the CAS number 87460-09-1. It is an organophosphorus compound with a complex structure that includes benzene, hydroxy, and phosphorus moieties. This compound is typically colorless and has a specific odor. It is synthesized for use in various applications due to its unique chemical properties.

About

CAS No 87460-09-1
English Name Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate
Molecular Formula C19H23O4P
Molecular Weight 346.36 g/mol
SMILES C1=CC=C(C=C1)CCCCP(=O)(CC(=O)OCC2=CC=CC=C2)O
InChIKey GVDMCYBWLREELG-UHFFFAOYSA-N
Last Updated: 2025-10-12 15:22

Related Q&A

Compound Q&A

What are the main uses of Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1)?

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate is primarily used in pharmaceuticals as a potential ...

Compound Q&A

Is Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1) safe?

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate is generally considered safe for laboratory use when...

Compound Q&A

How should Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate (CAS: 87460-09-1) be stored?

Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...