Compound Q&A

What are the main uses of Coptisine sulfate (CAS: 1198398-71-8)?

Answer

Coptisine sulfate
Coptisine sulfate is primarily used in pharmaceuticals for its anti-inflammatory and antimicrobial effects. It is also used in traditional Chinese medicine and is studied for its potential in developing new drugs for infections and inflammatory diseases.

About

English Name Coptisine sulfate
Molecular Formula C19H15NO8S
Molecular Weight 417.39 g/mol
SMILES C1Oc2c(O1)cc1c(c2)CC[n+]2c1cc1ccc3c(c1c2)OCO3.[O-]OS(=O)=O
InChIKey MHVVFMWLVSKBQZ-UHFFFAOYSA-L
Last Updated: 2025-10-12 11:11

Related Q&A

Compound Q&A

What is Coptisine sulfate (CAS: 1198398-71-8)?

Coptisine sulfate is a derivative of the alkaloid coptisine, commonly found in the root of the Copti...

Compound Q&A

Is Coptisine sulfate (CAS: 1198398-71-8) safe?

Coptisine sulfate is generally considered safe when used as directed in pharmaceutical applications....

Compound Q&A

How should Coptisine sulfate (CAS: 1198398-71-8) be stored?

Coptisine sulfate should be stored in a tightly sealed container at room temperature, between 15-30°...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...