Compound Q&A

What is Coptisine sulfate (CAS: 1198398-71-8)?

Answer

Coptisine sulfate
Coptisine sulfate is a derivative of the alkaloid coptisine, commonly found in the root of the Coptis chinensis plant. It has the chemical formula C17H18N2O4·H2SO4. Coptisine sulfate exhibits antimicrobial and anti-inflammatory properties.

About

English Name Coptisine sulfate
Molecular Formula C19H15NO8S
Molecular Weight 417.39 g/mol
SMILES C1Oc2c(O1)cc1c(c2)CC[n+]2c1cc1ccc3c(c1c2)OCO3.[O-]OS(=O)=O
InChIKey MHVVFMWLVSKBQZ-UHFFFAOYSA-L
Last Updated: 2025-10-12 11:11

Related Q&A

Compound Q&A

What are the main uses of Coptisine sulfate (CAS: 1198398-71-8)?

Coptisine sulfate is primarily used in pharmaceuticals for its anti-inflammatory and antimicrobial e...

Compound Q&A

Is Coptisine sulfate (CAS: 1198398-71-8) safe?

Coptisine sulfate is generally considered safe when used as directed in pharmaceutical applications....

Compound Q&A

How should Coptisine sulfate (CAS: 1198398-71-8) be stored?

Coptisine sulfate should be stored in a tightly sealed container at room temperature, between 15-30°...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...