Compound Q&A

How is 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) typically synthesized?

Answer

1,2,3-Propanetriyl tribenzoate
1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) is typically synthesized via an esterification reaction between benzoic acid and 1,2,3-propanetriol (glycerol). Common catalysts include sulfuric acid or phosphoric acid, and the reaction involves the stepwise substitution of hydroxyl groups in glycerol with benzoic acid moieties. The yield can be improved by using a suitable catalyst and optimizing reaction conditions.

About

CAS No 614-33-5
English Name 1,2,3-Propanetriyl tribenzoate
Molecular Formula C24H20O6
Molecular Weight 404.42 g/mol
SMILES c1ccc(cc1)C(=O)OCC(COC(=O)c2ccccc2)OC(=O)c3ccccc3
InChIKey HIZCTWCPHWUPFU-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5)?

1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) is a solid at room temperature with a crystalline for...

Compound Q&A

What industries use 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5)?

1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) is used in various industries. It is a key component ...

Compound Q&A

What precautions should be taken when handling 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5)?

When handling 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5), appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...