Compound Q&A

What are the physical and chemical properties of 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5)?

Answer

1,2,3-Propanetriyl tribenzoate
1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) is a solid at room temperature with a crystalline form. Its molecular weight is approximately 316.2 g/mol. It is soluble in organic solvents like acetone and toluene but slightly soluble in water. The compound is chemically stable but can react with strong bases. It has a pKa value of around 5, indicating a weak acid character.

About

CAS No 614-33-5
English Name 1,2,3-Propanetriyl tribenzoate
Molecular Formula C24H20O6
Molecular Weight 404.42 g/mol
SMILES c1ccc(cc1)C(=O)OCC(COC(=O)c2ccccc2)OC(=O)c3ccccc3
InChIKey HIZCTWCPHWUPFU-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) typically synthesized?

1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) is typically synthesized via an esterification reacti...

Compound Q&A

What industries use 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5)?

1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5) is used in various industries. It is a key component ...

Compound Q&A

What precautions should be taken when handling 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5)?

When handling 1,2,3-Propanetriyl tribenzoate (CAS: 614-33-5), appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...