Compound Q&A

What industries use 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8)?

Answer

2,6-Dibromo-3-nitropyridine
2,6-Dibromo-3-nitropyridine is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It also finds applications in the production of dyes and pigments, and as a precursor in the semiconductor industry for the development of novel electronic materials. Its role in sensors and other specialized chemical applications is also recognized.

About

CAS No 55304-80-8
English Name 2,6-Dibromo-3-nitropyridine
Molecular Formula C5H2Br2N2O2
Molecular Weight 281.89 g/mol
SMILES C1=CC(=NC(=C1[N+](=O)[O-])Br)Br
InChIKey FFRFTURYWWFKIC-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8)?

2,6-Dibromo-3-nitropyridine is a crystalline solid with a molecular weight of approximately 283.03 g...

Compound Q&A

How is 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8) typically synthesized?

2,6-Dibromo-3-nitropyridine can be synthesized through a nitration reaction of 2,6-dibromopyridine w...

Compound Q&A

What precautions should be taken when handling 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8)?

When handling 2,6-Dibromo-3-nitropyridine, it is essential to follow strict safety protocols. Wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...