Compound Q&A

How is 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8) typically synthesized?

Answer

2,6-Dibromo-3-nitropyridine
2,6-Dibromo-3-nitropyridine can be synthesized through a nitration reaction of 2,6-dibromopyridine with nitric acid in the presence of concentrated sulfuric acid as a catalyst. The reaction is carried out at high temperatures to ensure high yields. The key parameters include temperature control and the use of protective equipment to handle the corrosive and potentially toxic reactants.

About

CAS No 55304-80-8
English Name 2,6-Dibromo-3-nitropyridine
Molecular Formula C5H2Br2N2O2
Molecular Weight 281.89 g/mol
SMILES C1=CC(=NC(=C1[N+](=O)[O-])Br)Br
InChIKey FFRFTURYWWFKIC-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8)?

2,6-Dibromo-3-nitropyridine is a crystalline solid with a molecular weight of approximately 283.03 g...

Compound Q&A

What industries use 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8)?

2,6-Dibromo-3-nitropyridine is used in the pharmaceutical industry for the synthesis of certain medi...

Compound Q&A

What precautions should be taken when handling 2,6-Dibromo-3-nitropyridine (CAS: 55304-80-8)?

When handling 2,6-Dibromo-3-nitropyridine, it is essential to follow strict safety protocols. Wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...