Compound Q&A

How is Amberlite IRC 50 (CAS: 9002-29-3) typically synthesized?

Answer

Amberlite IRC 50
Amberlite IRC 50 is synthesized through a process involving copolymerization of styrene and divinylbenzene, followed by sulfonation. The resin is then modified to have a high sulfonic acid group content. Commonly used catalysts include sulfuric acid, and the synthesis process typically yields a product with high purity and uniform particle size.

About

CAS No 9002-29-3
English Name Amberlite IRC 50
Molecular Formula C23H37Cl2N3O
Molecular Weight 442.47 g/mol
SMILES CC1CCN(CCN1CC2=CC=CC=C2)C(=O)C3CC4CCCC(C3)C4N.Cl.Cl
InChIKey DPEYHNFHDIXMNV-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amberlite IRC 50 (CAS: 9002-29-3)?

Amberlite IRC 50 is a strong acid cation exchange resin with a crystalline form. It has a molecular ...

Compound Q&A

What industries use Amberlite IRC 50 (CAS: 9002-29-3)?

Amberlite IRC 50 is widely used in the pharmaceutical industry for the purification of APIs and inte...

Compound Q&A

What precautions should be taken when handling Amberlite IRC 50 (CAS: 9002-29-3)?

When handling Amberlite IRC 50, use chemical splash goggles and gloves. Store it in a well-ventilate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...