Compound Q&A

What are the physical and chemical properties of Amberlite IRC 50 (CAS: 9002-29-3)?

Answer

Amberlite IRC 50
Amberlite IRC 50 is a strong acid cation exchange resin with a crystalline form. It has a molecular weight of approximately 10,000 g/mol. The resin is insoluble in water and organic solvents. It exhibits high chemical stability and good thermal resistance. It is highly reactive towards various cations and has excellent exchange capacity and selectivity.

About

CAS No 9002-29-3
English Name Amberlite IRC 50
Molecular Formula C23H37Cl2N3O
Molecular Weight 442.47 g/mol
SMILES CC1CCN(CCN1CC2=CC=CC=C2)C(=O)C3CC4CCCC(C3)C4N.Cl.Cl
InChIKey DPEYHNFHDIXMNV-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is Amberlite IRC 50 (CAS: 9002-29-3) typically synthesized?

Amberlite IRC 50 is synthesized through a process involving copolymerization of styrene and divinylb...

Compound Q&A

What industries use Amberlite IRC 50 (CAS: 9002-29-3)?

Amberlite IRC 50 is widely used in the pharmaceutical industry for the purification of APIs and inte...

Compound Q&A

What precautions should be taken when handling Amberlite IRC 50 (CAS: 9002-29-3)?

When handling Amberlite IRC 50, use chemical splash goggles and gloves. Store it in a well-ventilate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...