Compound Q&A

What industries use Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0)?

Answer

Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate
Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) is primarily used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in the polymer industry for improving the thermal stability of polymers. Additionally, it can be used in the development of sensors and as a component in some semiconductor materials.

About

CAS No 67330-25-0
English Name Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate
Molecular Formula C18H18F3NO2
Molecular Weight 337.34 g/mol
SMILES CCCCOC(=O)C1=CC=CC=C1NC2=CC=CC(=C2)C(F)(F)F
InChIKey JDLSRXWHEBFHNC-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0)?

Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) is a crystalline solid with a m...

Compound Q&A

How is Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) typically synthesized?

Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) is typically synthesized throug...

Compound Q&A

What precautions should be taken when handling Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0)?

When handling Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0), it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...