Compound Q&A

How is Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) typically synthesized?

Answer

Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate
Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) is typically synthesized through a multistep process involving the coupling of 2-aminobenzoic acid and 3-(trifluoromethyl)aniline with butyl chloroformate as the coupling agent. The reaction conditions usually include the use of a suitable base like triethylamine and a solvent such as dichloromethane. The yield of the reaction is generally around 75-80%.

About

CAS No 67330-25-0
English Name Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate
Molecular Formula C18H18F3NO2
Molecular Weight 337.34 g/mol
SMILES CCCCOC(=O)C1=CC=CC=C1NC2=CC=CC(=C2)C(F)(F)F
InChIKey JDLSRXWHEBFHNC-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0)?

Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) is a crystalline solid with a m...

Compound Q&A

What industries use Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0)?

Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0)?

When handling Butyl 2-{[3-(trifluoromethyl)phenyl]amino}benzoate (CAS: 67330-25-0), it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...