Compound Q&A

What industries use 4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid (CAS: 71675-86-0)?

Answer

4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid
4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It is also utilized in the polymer industry for the development of advanced materials with specific properties. Additionally, it is used in the sensor and semiconductor industries for manufacturing high-performance electronic components.

About

CAS No 71675-86-0
English Name 4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid
Molecular Formula C10H13NO3S
Molecular Weight 227.29 g/mol
SMILES CCSC1=C(C=C(C(=C1)C(=O)O)OC)N
InChIKey BVCKAIGDWABZIE-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid (CAS: 71675-86-0)?

4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid (CAS: 71675-86-0) typically synthesized?

4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid is typically synthesized via a multi-step procedure ...

Compound Q&A

What precautions should be taken when handling 4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid (CAS: 71675-86-0)?

When handling 4-Amino-5-(ethylsulfanyl)-2-methoxybenzoic acid, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...