Compound Q&A

How is Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4) typically synthesized?

Answer

Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1)
Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) can be synthesized via a reaction between dichloropalladium and bis(2-methyl-2-propanyl)(phenyl)phosphine. This compound is typically prepared using palladium(II) chloride as the starting palladium source and the specified phosphine ligand. The synthesis involves careful control of reaction conditions to achieve high yield and selectivity.

About

CAS No 34409-44-4
English Name Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1)
Molecular Formula C28H46Cl2P2Pd
Molecular Weight 621.9 g/mol
SMILES CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.Cl[Pd]Cl
InChIKey QNNRAWADYXIGHE-UHFFFAOYSA-L
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4)?

Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) is a complex compound with a mol...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4)?

Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-proanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4)?

When handling Bis(2-methyl-2-proanyl)(phenyl)phosphine - dichloropalladium (2:1), safety measures in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...