Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4)?

Answer

Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1)
Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) is a complex compound with a molecular weight of approximately 414.1 g/mol. It exists as a solid with low solubility in water but good solubility in organic solvents. The compound is known for its reactivity in catalytic processes, particularly in cross-coupling reactions. It exhibits moderate reactivity and is often used in controlled reactions.

About

CAS No 34409-44-4
English Name Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1)
Molecular Formula C28H46Cl2P2Pd
Molecular Weight 621.9 g/mol
SMILES CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.Cl[Pd]Cl
InChIKey QNNRAWADYXIGHE-UHFFFAOYSA-L
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4) typically synthesized?

Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) can be synthesized via a reactio...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4)?

Bis(2-methyl-2-propanyl)(phenyl)phosphine - dichloropalladium (2:1) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-proanyl)(phenyl)phosphine - dichloropalladium (2:1) (CAS: 34409-44-4)?

When handling Bis(2-methyl-2-proanyl)(phenyl)phosphine - dichloropalladium (2:1), safety measures in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...