Compound Q&A

What industries use (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2)?

Answer

(9-Phenyl-9H-carbazol-2-yl)boronic acid
(9-Phenyl-9H-carbazol-2-yl)boronic acid finds applications in various industries. It is used in the pharmaceutical industry for the synthesis of complex organic compounds, in polymer science for the development of novel materials, and in semiconductor manufacturing for doping purposes. Additionally, it is employed in sensor technology for detecting specific chemical species.

About

English Name (9-Phenyl-9H-carbazol-2-yl)boronic acid
Molecular Formula C18H14BNO2
Molecular Weight 287.13 g/mol
SMILES B(C1=CC2=C(C=C1)C3=CC=CC=C3N2C4=CC=CC=C4)(O)O
InChIKey XSAOVBUSKVZIBE-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2)?

(9-Phenyl-9H-carbazol-2-yl)boronic acid is a colorless solid with a crystalline form. Its molecular ...

Compound Q&A

How is (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2) typically synthesized?

(9-Phenyl-9H-carbazol-2-yl)boronic acid is typically synthesized via a multistep process involving t...

Compound Q&A

What precautions should be taken when handling (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2)?

When handling (9-Phenyl-9H-carbazol-2-yl)boronic acid, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...