Compound Q&A

What are the physical and chemical properties of (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2)?

Answer

(9-Phenyl-9H-carbazol-2-yl)boronic acid
(9-Phenyl-9H-carbazol-2-yl)boronic acid is a colorless solid with a crystalline form. Its molecular weight is approximately 325.33 g/mol. This compound has limited solubility in common organic solvents but is slightly soluble in water. Chemically, it exhibits moderate reactivity with common functional groups, making it useful for various synthetic applications. It is stable under normal conditions but should be stored in a cool, dry place to prevent moisture absorption.

About

English Name (9-Phenyl-9H-carbazol-2-yl)boronic acid
Molecular Formula C18H14BNO2
Molecular Weight 287.13 g/mol
SMILES B(C1=CC2=C(C=C1)C3=CC=CC=C3N2C4=CC=CC=C4)(O)O
InChIKey XSAOVBUSKVZIBE-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2) typically synthesized?

(9-Phenyl-9H-carbazol-2-yl)boronic acid is typically synthesized via a multistep process involving t...

Compound Q&A

What industries use (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2)?

(9-Phenyl-9H-carbazol-2-yl)boronic acid finds applications in various industries. It is used in the ...

Compound Q&A

What precautions should be taken when handling (9-Phenyl-9H-carbazol-2-yl)boronic acid (CAS: 1001911-63-2)?

When handling (9-Phenyl-9H-carbazol-2-yl)boronic acid, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...