Compound Q&A

What industries use 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6)?

Answer

3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (1:1)
3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6) is used in the pharmaceutical industry for its potential as a precursor in drug synthesis. It is also explored in the sensor industry for its reactivity and in the semiconductor industry for its electronic properties. Additionally, it may find applications in polymer synthesis and as a chiral building block in organic synthesis.

About

CAS No 4876-14-6
English Name 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (1:1)
Molecular Formula C12H13ClN2O3
Molecular Weight 268.7 g/mol
SMILES C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.Cl
InChIKey MPTXVJCCTVAVNL-FVGYRXGTSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6)?

3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6) is a crystalline solid w...

Compound Q&A

How is 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6) typically synthesized?

3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride is typically synthesized through the reac...

Compound Q&A

What precautions should be taken when handling 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6)?

When handling 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...