Compound Q&A

How is 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6) typically synthesized?

Answer

3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (1:1)
3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride is typically synthesized through the reaction of 3-(2-aminooxyl-1,2-dihydro-4-quinolinyl)-L-alanine with hydrochloric acid. The reaction is carried out under controlled conditions, often using a mild acid catalyst. The yield and selectivity are high, and the product is isolated by recrystallization from appropriate solvents.

About

CAS No 4876-14-6
English Name 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (1:1)
Molecular Formula C12H13ClN2O3
Molecular Weight 268.7 g/mol
SMILES C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.Cl
InChIKey MPTXVJCCTVAVNL-FVGYRXGTSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6)?

3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6) is a crystalline solid w...

Compound Q&A

What industries use 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6)?

3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6) is used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6)?

When handling 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-L-alanine hydrochloride (CAS: 4876-14-6), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...