Compound Q&A

What industries use 2-Nitrobenzylcyanide (CAS: 610-66-2)?

Answer

2-Nitrobenzylcyanide
2-Nitrobenzylcyanide (CAS: 610-66-2) finds applications in various industries. It is primarily used in pharmaceuticals for the synthesis of certain drugs, in polymers for functionalizing materials, and in sensors for detection of specific analytes. Additionally, it plays a role in the development of semiconductors and as a reagent in organic synthesis.

About

CAS No 610-66-2
English Name 2-Nitrobenzylcyanide
Molecular Formula C8H6N2O2
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C(=C1)CC#N)[N+](=O)[O-]
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitrobenzylcyanide (CAS: 610-66-2)?

2-Nitrobenzylcyanide (CAS: 610-66-2) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is 2-Nitrobenzylcyanide (CAS: 610-66-2) typically synthesized?

2-Nitrobenzylcyanide (CAS: 610-66-2) is typically synthesized via the nitration of benzylcyanide fol...

Compound Q&A

What precautions should be taken when handling 2-Nitrobenzylcyanide (CAS: 610-66-2)?

When handling 2-Nitrobenzylcyanide (CAS: 610-66-2), it is essential to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...