Compound Q&A

How is 2-Nitrobenzylcyanide (CAS: 610-66-2) typically synthesized?

Answer

2-Nitrobenzylcyanide
2-Nitrobenzylcyanide (CAS: 610-66-2) is typically synthesized via the nitration of benzylcyanide followed by the introduction of a nitro group. Common methods include nitration with fuming nitric acid or concentrated nitric acid in the presence of sulfuric acid as a catalyst. The reaction is usually conducted at low temperatures to improve selectivity and yield.

About

CAS No 610-66-2
English Name 2-Nitrobenzylcyanide
Molecular Formula C8H6N2O2
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C(=C1)CC#N)[N+](=O)[O-]
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitrobenzylcyanide (CAS: 610-66-2)?

2-Nitrobenzylcyanide (CAS: 610-66-2) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use 2-Nitrobenzylcyanide (CAS: 610-66-2)?

2-Nitrobenzylcyanide (CAS: 610-66-2) finds applications in various industries. It is primarily used ...

Compound Q&A

What precautions should be taken when handling 2-Nitrobenzylcyanide (CAS: 610-66-2)?

When handling 2-Nitrobenzylcyanide (CAS: 610-66-2), it is essential to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...