Compound Q&A

What industries use Bexarotene Impurity 20 (CAS: 6683-48-3)?

Answer

Bexarotene Impurity 20
Bexarotene Impurity 20 (CAS: 6683-48-3) is primarily used in the pharmaceutical industry, particularly in the development and quality control of bexarotene-based medications. It is also of interest in research and development for its potential use in other therapeutic areas. This impurity plays a crucial role in ensuring the safety and efficacy of bexarotene products.

About

CAS No 6683-48-3
English Name Bexarotene Impurity 20
Molecular Formula C15H22
Molecular Weight 202.34 g/mol
SMILES CC1=CC2=C(C=C1)C(CCC2(C)C)(C)C
InChIKey AISXBZVAYNUAKB-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bexarotene Impurity 20 (CAS: 6683-48-3)?

Bexarotene Impurity 20 (CAS: 6683-48-3) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is Bexarotene Impurity 20 (CAS: 6683-48-3) typically synthesized?

Bexarotene Impurity 20 (CAS: 6683-48-3) can be synthesized through a multistep process involving alk...

Compound Q&A

What precautions should be taken when handling Bexarotene Impurity 20 (CAS: 6683-48-3)?

When handling Bexarotene Impurity 20 (CAS: 6683-48-3), users should wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...