Compound Q&A

What are the physical and chemical properties of Bexarotene Impurity 20 (CAS: 6683-48-3)?

Answer

Bexarotene Impurity 20
Bexarotene Impurity 20 (CAS: 6683-48-3) is a crystalline compound with a molecular weight of approximately 354.41 g/mol. It has a high solubility in organic solvents like methanol and ethanol. Chemically, it is less reactive compared to bexarotene but can undergo typical organic transformations under controlled conditions. This impurity is primarily used in pharmaceutical applications and its physicochemical properties are crucial for its identification and purification during drug development.

About

CAS No 6683-48-3
English Name Bexarotene Impurity 20
Molecular Formula C15H22
Molecular Weight 202.34 g/mol
SMILES CC1=CC2=C(C=C1)C(CCC2(C)C)(C)C
InChIKey AISXBZVAYNUAKB-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is Bexarotene Impurity 20 (CAS: 6683-48-3) typically synthesized?

Bexarotene Impurity 20 (CAS: 6683-48-3) can be synthesized through a multistep process involving alk...

Compound Q&A

What industries use Bexarotene Impurity 20 (CAS: 6683-48-3)?

Bexarotene Impurity 20 (CAS: 6683-48-3) is primarily used in the pharmaceutical industry, particular...

Compound Q&A

What precautions should be taken when handling Bexarotene Impurity 20 (CAS: 6683-48-3)?

When handling Bexarotene Impurity 20 (CAS: 6683-48-3), users should wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...