Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-(trifluoromethyl)benzaldehyde (CAS: 93118-03-7)?

Answer

2-Chloro-3-(trifluoromethyl)benzaldehyde
2-Chloro-3-(trifluoromethyl)benzaldehyde is a crystalline compound with a molecular weight of 266.01 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It is moderately reactive, showing electrophilic aromatic substitution and aldehyde chemistry. It has a melting point of 107-108°C and a boiling point of 245-247°C. The compound is non-flammable and has a low vapor pressure.

About

CAS No 93118-03-7
English Name 2-Chloro-3-(trifluoromethyl)benzaldehyde
Molecular Formula C8H4ClF3O
Molecular Weight 208.57 g/mol
SMILES C1=CC(=C(C(=C1)C(F)(F)F)Cl)C=O
InChIKey KUNCMOAFNYLOSC-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 2-Chloro-3-(trifluoromethyl)benzaldehyde (CAS: 93118-03-7) typically synthesized?

2-Chloro-3-(trifluoromethyl)benzaldehyde can be synthesized via the acylation of 3-(trifluoromethyl)...

Compound Q&A

What industries use 2-Chloro-3-(trifluoromethyl)benzaldehyde (CAS: 93118-03-7)?

2-Chloro-3-(trifluoromethyl)benzaldehyde is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-(trifluoromethyl)benzaldehyde (CAS: 93118-03-7)?

When handling 2-Chloro-3-(trifluoromethyl)benzaldehyde, it is crucial to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...