Compound Q&A

What industries use 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0)?

Answer

3-Bromo-7-nitro-1H-indazole
3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0) is primarily used in the pharmaceutical industry for the development of new drugs. It also finds applications in the synthesis of organic semiconductors and as a reagent in polymer chemistry. Its unique chemical structure makes it valuable for research in materials science and sensor technologies.

About

CAS No 74209-34-0
English Name 3-Bromo-7-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=CC2=C(NN=C2C(=C1)[N+](=O)[O-])Br
InChIKey NFSTZPMYAZRZPC-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0)?

3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0) is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0) typically synthesized?

3-Bromo-7-nitro-1H-indazole is typically synthesized via bromination and nitration of indazole. Comm...

Compound Q&A

What precautions should be taken when handling 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0)?

When handling 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...