Compound Q&A

What are the physical and chemical properties of 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0)?

Answer

3-Bromo-7-nitro-1H-indazole
3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0) is a crystalline solid with a molecular weight of approximately 271.03 g/mol. It has a low solubility in water but is soluble in common organic solvents like methanol and dimethylformamide. Chemically, it is reactive towards nucleophiles and reducing agents. It exhibits good stability under normal conditions but should be stored in a dry environment to avoid hydrolysis.

About

CAS No 74209-34-0
English Name 3-Bromo-7-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=CC2=C(NN=C2C(=C1)[N+](=O)[O-])Br
InChIKey NFSTZPMYAZRZPC-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0) typically synthesized?

3-Bromo-7-nitro-1H-indazole is typically synthesized via bromination and nitration of indazole. Comm...

Compound Q&A

What industries use 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0)?

3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0)?

When handling 3-Bromo-7-nitro-1H-indazole (CAS: 74209-34-0), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...