Compound Q&A

How is 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2) typically synthesized?

Answer

1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-
This compound is synthesized via a multi-step process involving the condensation of 2-chlorophenyl and 4-fluorophenyl oxirane with 1,2,4-triazole. Commonly, this involves the use of a Lewis acid catalyst, such as aluminum chloride, to facilitate the cyclization reaction, leading to high yields and good selectivity.

About

English Name 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-
Molecular Formula C17H13ClFN3O
Molecular Weight 329.76 g/mol
SMILES Fc1ccc(cc1)[C@@]1(Cn2cncn2)O[C@H]1c1ccccc1Cl
InChIKey ZMYFCFLJBGAQRS-DLBZAZTESA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2)?

1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] is a solid compound with...

Compound Q&A

What industries use 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2)?

This compound is primarily used in the pharmaceutical industry for the development of new drugs and ...

Compound Q&A

What precautions should be taken when handling 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...