Compound Q&A

What are the physical and chemical properties of 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2)?

Answer

1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-
1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] is a solid compound with a molecular weight of approximately 394.03 g/mol. It has a high melting point and is poorly soluble in water but soluble in organic solvents like DMSO. The compound is known for its reactivity, particularly in nucleophilic substitution reactions.

About

English Name 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-
Molecular Formula C17H13ClFN3O
Molecular Weight 329.76 g/mol
SMILES Fc1ccc(cc1)[C@@]1(Cn2cncn2)O[C@H]1c1ccccc1Cl
InChIKey ZMYFCFLJBGAQRS-DLBZAZTESA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2) typically synthesized?

This compound is synthesized via a multi-step process involving the condensation of 2-chlorophenyl a...

Compound Q&A

What industries use 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2)?

This compound is primarily used in the pharmaceutical industry for the development of new drugs and ...

Compound Q&A

What precautions should be taken when handling 1H-1,2,4-Triazole,1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl] (CAS: 135319-73-2)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...