Compound Q&A

What industries use 4-Bromophenylalanine (CAS: 62561-74-4)?

Answer

4-Bromophenylalanine
4-Bromophenylalanine, CAS 62561-74-4, is primarily used in the pharmaceutical industry for the synthesis of various drug candidates, particularly those requiring modifications of amino acid structures. It is also used in polymer science for the development of novel materials and in sensor technology for detection of specific compounds. Additionally, it has potential applications in semiconductor manufacturing for the production of advanced materials.

About

CAS No 62561-74-4
English Name 4-Bromophenylalanine
Molecular Formula C9H10BrNO2
Molecular Weight 244.09 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)Br
InChIKey PEMUHKUIQHFMTH-MRVPVSSYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromophenylalanine (CAS: 62561-74-4)?

4-Bromophenylalanine, CAS 62561-74-4, is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-Bromophenylalanine (CAS: 62561-74-4) typically synthesized?

4-Bromophenylalanine can be synthesized from phenylalanine via bromination reactions. Typically, phe...

Compound Q&A

What precautions should be taken when handling 4-Bromophenylalanine (CAS: 62561-74-4)?

When handling 4-Bromophenylalanine, CAS 62561-74-4, it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...