Compound Q&A

What industries use 2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0)?

Answer

2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one
2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0) finds applications in the pharmaceutical industry as a precursor for drug development, particularly in the synthesis of active pharmaceutical ingredients. It is also used in the polymer industry as a chromophore for colorants and dyes. Additionally, it has potential uses in sensor technology and semiconductor manufacturing, where its chromophoric properties are utilized.

About

CAS No 855-97-0
English Name 2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one
Molecular Formula C19H18O6
Molecular Weight 342.35 g/mol
SMILES COc1cc(OC)c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)OC
InChIKey CLXVBVLQKLQNRQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0)?

2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0) is a crystalline compound wit...

Compound Q&A

How is 2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0) typically synthesized?

2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0) can be synthesized via a mult...

Compound Q&A

What precautions should be taken when handling 2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0)?

When handling 2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one (CAS: 855-97-0), it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...