Compound Q&A

How is 1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride (CAS: 867165-53-5) typically synthesized?

Answer

1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride
1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride is typically synthesized via a multi-step process involving the reaction of 3-chloro-2-pyrazinecarbothioic acid methyl ester with methylamine followed by HCl addition to form the dihydrochloride salt. The synthesis involves careful control of pH and temperature to enhance selectivity and yield.

About

English Name 1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride
Molecular Formula C5H8Cl3N3
Molecular Weight 216.5 g/mol
SMILES NCC1=NC=CN=C1Cl.[H]Cl.[H]Cl
InChIKey RHKWGVWUXBFIIE-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride (CAS: 867165-53-5)?

1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride is a crystalline compound with a molecular weigh...

Compound Q&A

What industries use 1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride (CAS: 867165-53-5)?

1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride is used in the pharmaceutical industry for its p...

Compound Q&A

What precautions should be taken when handling 1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride (CAS: 867165-53-5)?

When handling 1-(3-Chloro-2-pyrazinyl)methanamine dihydrochloride, it is essential to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...