Compound Q&A

How is Fluoxetine hydrochloride (CAS: 59333-67-4) typically synthesized?

Answer

Fluoxetine hydrochloride
Fluoxetine hydrochloride is synthesized through a multi-step process starting with fluvoxamine. The key steps involve the conversion of fluvoxamine to fluoxetine, followed by the chloride formation using hydrochloric acid. The reaction is typically carried out in a solvent such as ethanol under mild conditions.

About

CAS No 59333-67-4
English Name Fluoxetine hydrochloride
Molecular Formula C17H19ClF3NO
Molecular Weight 345.8 g/mol
SMILES CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F.Cl
InChIKey GIYXAJPCNFJEHY-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fluoxetine hydrochloride (CAS: 59333-67-4)?

Fluoxetine hydrochloride is a white or slightly yellow crystalline powder with a molecular weight of...

Compound Q&A

What industries use Fluoxetine hydrochloride (CAS: 59333-67-4)?

Fluoxetine hydrochloride is primarily used in the pharmaceutical industry as an antidepressant. It i...

Compound Q&A

What precautions should be taken when handling Fluoxetine hydrochloride (CAS: 59333-67-4)?

When handling Fluoxetine hydrochloride, ensure proper personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...