Compound Q&A

How is 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1) typically synthesized?

Answer

2,4-Dichloro-1-(trichloromethyl)benzene
2,4-Dichloro-1-(trichloromethyl)benzene is usually synthesized via the reaction of 2,4-dichlorobenzoyl chloride with trichloromethyl chloride in the presence of a Lewis acid catalyst, such as aluminum trichloride. The process requires careful control of temperature and reaction time to achieve high yield and selectivity.

About

CAS No 13014-18-1
English Name 2,4-Dichloro-1-(trichloromethyl)benzene
Molecular Formula C7H3Cl5
Molecular Weight 264.37 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(Cl)(Cl)Cl
InChIKey KZSNBJMYJWDVTK-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1)?

2,4-Dichloro-1-(trichloromethyl)benzene is a crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1)?

2,4-Dichloro-1-(trichloromethyl)benzene is primarily used in the synthesis of dyes and pigments. It ...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1)?

Laboratory handling of 2,4-Dichloro-1-(trichloromethyl)benzene requires the use of appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...